PROSTAGLANDIN B1 manufacturers
|
| | PROSTAGLANDIN B1 Basic information |
| Product Name: | PROSTAGLANDIN B1 | | Synonyms: | [13E,15S]-15-HYDROXY-9-OXOPROSTA-8[12],13-DIEN-1-OIC ACID;7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxo-1-cyclopentenyl]heptanoic acid;(13E,15S)-15-Hydroxy-9-oxoprosta-8(12),13-dien-1-oic acid, PGB1;(-)-(E)-Prostaglandin E1-278;PGE1-278;Prostaglandin E1-278;(+)-2-[(E,R)-3-Hydroxy-1-octenyl]-5-oxo-1-cyclopentene-1-heptanoic acid;[13E,15R,(+)]-15-Hydroxy-9-oxo-8,12-didehydroprost-13-en-1-oic acid | | CAS: | 13345-51-2 | | MF: | C20H32O4 | | MW: | 336.47 | | EINECS: | 234-237-8 | | Product Categories: | | | Mol File: | 13345-51-2.mol |  |
| | PROSTAGLANDIN B1 Chemical Properties |
| Melting point | 69-71°C | | Boiling point | 531.4±43.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | acetone: 20 mg/mL, clear, colorless to very faintly yellow | | pka | 4.77±0.10(Predicted) | | form | powder | | color | white to light yellow | | biological source | synthetic | | BRN | 2004447 | | Stability: | Light Sensitive | | InChI | 1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12,14,17,21H,2-11,13,15H2,1H3,(H,23,24)/b14-12+/t17-/m0/s1 | | InChIKey | YBHMPNRDOVPQIN-VSOYFRJCSA-N | | SMILES | O=C1C(CCCCCCC(O)=O)=C(/C=C/[C@H](CCCCC)O)CC1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2937500000 | | Storage Class | 10 - Combustible liquids |
| | PROSTAGLANDIN B1 Usage And Synthesis |
| Uses | Prostaglandin B1 is a novel microbial biopolymer which has been shown to improve the longevity of type 2 diabetic rodents. Oligomers of prostaglandin B1 inhibit arachidonic acid mobilization in human neutrophils and endothelial cells. | | Definition | ChEBI: Prostaglandin B1 is a member of the class of prostaglandins B that is prosta-8(12),13-dien-1-oic acid carrying oxo and hydroxy substituents at positions 9 and 15 respectively (the 13E,15S-stereoisomer). It has a role as a human metabolite. It is a conjugate acid of a prostaglandin B1(1-). | | Biological Activity | Prostaglandin B1 (PGB1) is a metabolic product of PGE1 dehydration. It is known to specifically bind to peroxisome proliferator-activated receptor-γ. By this, PGB1 mediates f at accumulation and metabolism. Oligomerization of PGB1 potentiates its anti-oxidative property. | | Enzyme inhibitor | This eicosanoid (FWB1 (free-acid) = 336.47 g/mol; CAS 13345-51-2, for PGB1,
and 39306-29-1, for Bx) is a metabolite of prostaglandin E1: prostaglandin
Bx is an oligomer of prostaglandin B1. The X-ray crystal structure of
prostaglandin B1 suggests this prostaglandin has an unusual L-shaped
configuration, with the a and w side chains roughly perpendicular to one
another. The 15-hydroxyl group, which is normally directed away from
the centroid of the prostaglandin in the standard hairpin mod+el, is turned
inward in prostaglandin B1. Target (s) : FoF1 ATPase, or H-transporting
two-sector ATPase, inhibited by prostaglandin Bx; 15-
hydroxyprostaglandin dehydrogenase; phospholipase A2, inhibited by
prostaglandin Bx. |
| | PROSTAGLANDIN B1 Preparation Products And Raw materials |
|