|
|
| | 2-Amino-4-methyl-5-acetylthiazole Basic information |
| | 2-Amino-4-methyl-5-acetylthiazole Chemical Properties |
| Melting point | 268-272 °C (dec.) (lit.) | | Boiling point | 312.8±22.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 3.58±0.10(Predicted) | | color | White to Orange to Green | | Water Solubility | Insoluble | | BRN | 127111 | | InChI | InChI=1S/C6H8N2OS/c1-3-5(4(2)9)10-6(7)8-3/h1-2H3,(H2,7,8) | | InChIKey | PKUKCASRNJIQNU-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC(N)=NC=1C)C | | CAS DataBase Reference | 30748-47-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 36/37/39-26-36/37 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29341000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4-methyl-5-acetylthiazole Usage And Synthesis |
| Chemical Properties | white to off-white powder |
| | 2-Amino-4-methyl-5-acetylthiazole Preparation Products And Raw materials |
|