L-Propargylglycine HCL manufacturers
- D-Propargylglycine
-
- $1.00 / 1KG
-
2020-01-01
- CAS:198774-27-5
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | L-Propargylglycine HCL Basic information |
| Product Name: | L-Propargylglycine HCL | | Synonyms: | L-Propargylglycine HCL;(2S)-2-Aminopent-4-ynoic acid;D-Propargylglycine;(2S)-2-azanylpent-4-ynoic acid;4-Pentynoicacid, 2-aMino-, hydrochloride (1:1), (2S)-;L-Propargylglycine L-Propargylglycine;H-Gly(Propargyl)-OH.HCl;RARECHEM BK PT 0255 | | CAS: | 198774-27-5 | | MF: | C5H8ClNO2 | | MW: | 149.57 | | EINECS: | 200-528-9 | | Product Categories: | API intermediates;Amino Acids | | Mol File: | 198774-27-5.mol |  |
| | L-Propargylglycine HCL Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1/C5H7NO2.ClH/c1-2-3-4(6)5(7)8;/h1,4H,3,6H2,(H,7,8);1H/t4-;/s3 | | InChIKey | UAMBUICGODABQY-NDILARRWNA-N | | SMILES | [C@@H](N)(C(=O)O)CC#C.Cl |&1:0,r| | | CAS DataBase Reference | 198774-27-5(CAS DataBase Reference) |
| | L-Propargylglycine HCL Usage And Synthesis |
| | L-Propargylglycine HCL Preparation Products And Raw materials |
|