|
|
| | 2,3-Pyrazinecarboxylic anhydride Basic information |
| | 2,3-Pyrazinecarboxylic anhydride Chemical Properties |
| Melting point | 210 °C (dec.)(lit.) | | Boiling point | 357.3±22.0 °C(Predicted) | | density | 1.686±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Actonitrile (Slightly), DMSO | | form | Solid | | pka | -3.43±0.20(Predicted) | | color | White to light brown crystalline powder | | InChI | InChI=1S/C6H2N2O3/c9-5-3-4(6(10)11-5)8-2-1-7-3/h1-2H | | InChIKey | AWJWCTOOIBYHON-UHFFFAOYSA-N | | SMILES | C12C(=O)OC(=O)C1=NC=CN=2 | | LogP | -0.900 (est) | | CAS DataBase Reference | 4744-50-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29349990 |
| | 2,3-Pyrazinecarboxylic anhydride Usage And Synthesis |
| Uses | 2,?3-?Pyrazinedicarboxylic Anhydride is a reagent used in the synthesis of highly potent and selective abietane type diterpenoid amides. | | Synthesis | Pyrazine-2,3-dicarboxylic acid (4.0 g, 23.8 mmol) was dissolved in acetic anhydride (30 mL).The reaction mixture was refluxed for one hour, and subsequently cooled down to 0 °C in ice bath.The obtained crystals of pyrazine-2,3-dicarboxylic anhydride were filtered off (yield 70%).
 | | References | [1] Molecules, 2017, vol. 22, # 9,
[2] Journal of the American Chemical Society, 1953, vol. 75, p. 679
[3] Helvetica Chimica Acta, 1958, vol. 41, p. 498,509 |
| | 2,3-Pyrazinecarboxylic anhydride Preparation Products And Raw materials |
|