| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:2-NITROBENZENESULFENYL CHLORIDE(13C6, 99%) CAS:639824-67-2 Purity:98% Package:G Remarks:CLM-6586-0
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-Nitrobenzenesulfenyl chloride-13C6 CAS:639824-67-2
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:639824-67-2
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | 2-Nitrobenzenesulfenyl chloride-13C6 Basic information |
| | 2-Nitrobenzenesulfenyl chloride-13C6 Chemical Properties |
| Melting point | 72-75 °C(lit.) | | storage temp. | 2-8°C | | InChI | 1S/C6H4ClNO2S/c7-11-6-4-2-1-3-5(6)8(9)10/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | NTNKNFHIAFDCSJ-IDEBNGHGSA-N | | SMILES | [O-][N+](=O)[13c]1[13cH][13cH][13cH][13cH][13c]1SCl |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Nitrobenzenesulfenyl chloride-13C6 Usage And Synthesis |
| Uses | - High-resolution NMR spectroscopy - Metabolomic profiling and pathway analysis - Stable Isotope probing in Environmental microbiology - Chlorination reaction mechanism studies |
| | 2-Nitrobenzenesulfenyl chloride-13C6 Preparation Products And Raw materials |
|