| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene Basic information |
| Product Name: | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene | | Synonyms: | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene;5,5μ-Di(4-biphenylyl)-2,2μ-bithiophene;5,5'-di(biphenyl-4-yl)-2,2'-bithiophene;BP2T;5,5'-Di(4-biphenylyl)-2,2'-bithiophene 97%;2,2'-Bithiophene, 5,5'-bis([1,1'-biphenyl]-4-yl)-;5,5′-Bis([1,1′-biphenyl]-4-yl)-2,2′-bithiophene;5,5'-Di([1,1'-biphenyl]-4-yl)-2,2'-bithiophene | | CAS: | 175850-28-9 | | MF: | C32H22S2 | | MW: | 470.65 | | EINECS: | | | Product Categories: | | | Mol File: | 175850-28-9.mol | ![5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene Structure](CAS/GIF/175850-28-9.gif) |
| | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene Chemical Properties |
| Melting point | 368-374 °C | | Boiling point | 660.3±50.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | form | solid | | semiconductor properties | P-type (mobility=0.04cm2/V·s) | | InChI | 1S/C32H22S2/c1-3-7-23(8-4-1)25-11-15-27(16-12-25)29-19-21-31(33-29)32-22-20-30(34-32)28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-22H | | InChIKey | SJNXLFCTPWBYSE-UHFFFAOYSA-N | | SMILES | c1ccc(cc1)-c2ccc(cc2)-c3ccc(s3)-c4ccc(s4)-c5ccc(cc5)-c6ccccc6 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene Usage And Synthesis |
| Uses | p-type organic semiconductor |
| | 5,5μ-[Di(1,1μ-biphenyl)-4-yl]-2,2μ-bithiophene Preparation Products And Raw materials |
|