| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine Basic information |
| | Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine Chemical Properties |
| Melting point | 103-108 °C | | Boiling point | 446.5±28.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.66±0.24(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H32NP/c1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h13-16,18-19H,3-12H2,1-2H3 | | InChIKey | RKUHKZXJHGGGSK-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(P(C2CCCCC2)C2CCCCC2)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine Usage And Synthesis |
| Uses | Catalyst for cycloaddition reactions in the presence of rhodium-catalysts. | | Uses | - Catalyst for cycloaddition reactions in the presence of rhodium-catalysts
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings |
| | Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine Preparation Products And Raw materials |
|