- 37-Azido-2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontane
-
-
2026-02-05
- CAS:89485-61-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 89485-61-0
- m-PEG36-azido
-
-
2025-06-07
- CAS:89485-61-0
- Min. Order: 500mg
- Purity: >95.00%
- Supply Ability: 500mg
|
| | PEG-Azide, O-(2-Azidoethyl)-Oμ-methylpolyethylene glycol Basic information |
| | PEG-Azide, O-(2-Azidoethyl)-Oμ-methylpolyethylene glycol Chemical Properties |
| Melting point | 45-50 °C | | density | 1.105 g/mL at 25 °C | | refractive index | n20/D1.458 | | Fp | >110°C | | storage temp. | -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | solid | | α-end | methoxy | | Ω-end | azide | | InChIKey | KNQIUZXKKMWVQW-UHFFFAOYSA-N | | SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])OC |
| WGK Germany | 3 | | HS Code | 39072090 | | Storage Class | 11 - Combustible Solids |
| | PEG-Azide, O-(2-Azidoethyl)-Oμ-methylpolyethylene glycol Usage And Synthesis |
| Description | m-PEG12-azide is a aqueous soluble monodisperse PEG linker. The azide group can react with alkyne, BCN, DBCO via Click Chemistry. | | Uses | PEG functionalized with azide is commonly used in copper-mediated ligation (click chemistry). PEG of this molecular weight should remain amorphous at room temperature. | | reaction suitability | reagent type: chemical modification reagent reagent type: cross-linking reagent reaction type: click chemistry |
| | PEG-Azide, O-(2-Azidoethyl)-Oμ-methylpolyethylene glycol Preparation Products And Raw materials |
|