| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine Basic information |
| Product Name: | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine | | Synonyms: | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine;N-[α-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic amide;Phosphinic amide, N-[[(4-methylphenyl)sulfonyl]phenylmethyl]-P,P-diphenyl-;N-[alpha-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic amide;N-[α-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic Amide;N-[α-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic amide;N-[α-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic amide, CAS 701291-86-3 | | CAS: | 701291-86-3 | | MF: | C26H24NO3PS | | MW: | 461.51 | | EINECS: | | | Product Categories: | | | Mol File: | 701291-86-3.mol |  |
| | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine Chemical Properties |
| Melting point | 140-144 °C | | Boiling point | 656.4±65.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | -3.13±0.70(Predicted) | | form | solid | | InChI | 1S/C26H24NO3PS/c1-21-17-19-25(20-18-21)32(29,30)26(22-11-5-2-6-12-22)27-31(28,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20,26H,1H3,(H,27,28) | | InChIKey | PNTGCTVNEJGLKY-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)C(NP(=O)(c2ccccc2)c3ccccc3)c4ccccc4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine Usage And Synthesis |
| Uses | N-[α-(4-Methylphenyl)sulfonyl)benzyl]diphenylphosphinic Amide is a useful reagent for the synthesis of organic intermediates. |
| | N-(Diphenylphosphinyl-α-(p-tosyl)benzyl amine Preparation Products And Raw materials |
|