| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine Basic information |
| Product Name: | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine | | Synonyms: | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine;(Rp)-1-[(1S)-(1-Aminoethyl)]-2-(diphenylphosphino)ferrocene;(R)-1-((S)-2-Diphenylphosphino)ferrocenylethylamine;(R)-1-((S)-2-Diphenylphosphino)ferrocenylethylaMine, Min. 97%;(2R)-1-[(1S)-1-Aminoethyl]-2-(diphenylphosphino)ferrocene;(S)-1-[(R)-2-(Diphenylphosphino)ferrocenyl]ethylaMine, 97+%;(Rp)-1-[(1S)-(1-Aminoethyl)]-2-(diphenylphosphino)ferrocene 97%;(R)-1-((S)-2-DIPHENYLPHOSPHINO)FERROCENYLETHYLAMINE,MIN.97% | | CAS: | 607389-84-4 | | MF: | C19H19NP.C5H5.Fe | | MW: | 413.28 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 607389-84-4.mol | ![(Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine Structure](CAS/GIF/607389-84-4.gif) |
| | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine Chemical Properties |
| Melting point | 251-253℃ (dichloromethane ligroine ) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | color | yellow | | Sensitive | air sensitive | | InChI | 1S/C19H19NP.C5H5.Fe/c1-15(20)18-13-8-14-19(18)21(16-9-4-2-5-10-16)17-11-6-3-7-12-17;1-2-4-5-3-1;/h2-15H,20H2,1H3;1-5H;/t15-;;/m0../s1 | | InChIKey | DRBVPPSGNFMTKZ-CKUXDGONSA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@H](N)[C]2[CH][CH][CH][C]2P(c3ccccc3)c4ccccc4 |
| RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine Usage And Synthesis |
| Uses | (S)-1-[(R)-2-(Diphenylphosphino)ferrocenyl]ethylamine is used as pharmaceutical intermediates. |
| | (Rp)-1-(1S)-[(2-Diphenylphosphino)ferrocenyl]ethanamine Preparation Products And Raw materials |
|