|
|
| | 2,6-Dibromo-4-methylpyridine Basic information | | Uses |
| | 2,6-Dibromo-4-methylpyridine Chemical Properties |
| Melting point | 77-79℃ | | Boiling point | 283℃ | | density | 1.911 | | Fp | 125℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.00±0.10(Predicted) | | form | powder | | color | White | | InChI | InChI=1S/C6H5Br2N/c1-4-2-5(7)9-6(8)3-4/h2-3H,1H3 | | InChIKey | OHBIPNNTWKNAGC-UHFFFAOYSA-N | | SMILES | C1(Br)=NC(Br)=CC(C)=C1 |
| RIDADR | UN2811 | | HS Code | 2933399990 |
| | 2,6-Dibromo-4-methylpyridine Usage And Synthesis |
| Uses | 2,6-Dibromo-4-methylpyridine is a heterocyclic organic compound used as an optoelectronic material. |
| | 2,6-Dibromo-4-methylpyridine Preparation Products And Raw materials |
|