Itaconic acid monomethyl ester manufacturers
|
| | Itaconic acid monomethyl ester Basic information |
| Product Name: | Itaconic acid monomethyl ester | | Synonyms: | METHYL ITACONATE;METHYL ACID ITACONATE;Methyl itaconate, 98 %;2-Methylenebutanedioic acid 4-methyl ester;2-Methylenesuccinic acid 4-methyl ester;3-Methylenebutanedioic acid 1-methyl ester;3-Methylenesuccinic acid hydrogen 1-methyl ester;3-Monomethyl 1-propene-2,3-dicarboxylate | | CAS: | 7338-27-4 | | MF: | C6H8O4 | | MW: | 144.13 | | EINECS: | 230-853-6 | | Product Categories: | monomer | | Mol File: | 7338-27-4.mol |  |
| | Itaconic acid monomethyl ester Chemical Properties |
| Melting point | 72°C | | Boiling point | 149 °C / 10mmHg | | density | 1.195±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.59±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C6H8O4/c1-4(6(8)9)3-5(7)10-2/h1,3H2,2H3,(H,8,9) | | InChIKey | OIYTYGOUZOARSH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(=C)CC(OC)=O |
| | Itaconic acid monomethyl ester Usage And Synthesis |
| Description | Monomethyl itaconate is a copolymerization reagent and an active metabolite of the prodrug SCD-153.1,2,3 It has also been found in U. maydis.4 Monomethyl itaconate has been used in the generation of copolymeric hydrogels for the formation of methotrexate-containing polymer disks.2 Monomethyl itaconate has been used in the synthesis of thrombin inhibitors.5WARNING This product is not for human or veterinary use. |
| | Itaconic acid monomethyl ester Preparation Products And Raw materials |
|