| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-NONEN-2-ONE manufacturers
- 3-NONEN-2-ONE
-
-
2026-06-30
- CAS:18402-83-0
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 3-NONEN-2-ONE Basic information |
| | 3-NONEN-2-ONE Chemical Properties |
| Boiling point | 85 °C12 mm Hg(lit.) | | density | 0.848 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | 179 °F | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | 1S/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7+ | | InChIKey | HDKLIZDXVUCLHQ-BQYQJAHWSA-N | | SMILES | [H]\C(CCCCC)=C(\[H])C(C)=O | | LogP | 2.689 (est) |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 3-NONEN-2-ONE Usage And Synthesis |
| Uses | trans-3-Nonen-2-one is a useful reagent in the synthesis of olivetolic acid (O533005). | | Definition | ChEBI: (3E)-3-nonen-2-one is an enone that is (E)-3-nonene in which the two methylene hydrogens at position 2 have been replaced by an oxo group. It has a role as an EC 2.5.1.18 (glutathione transferase) inhibitor and a fumigant. |
| | 3-NONEN-2-ONE Preparation Products And Raw materials |
|