| Company Name: |
skychemical Co.Ltd |
| Tel: |
021-20960837,QQ1332204249 |
| Email: |
sales@skychemical.com |
|
| | 4'-(Dimethylamino)propiophenone Basic information |
| Product Name: | 4'-(Dimethylamino)propiophenone | | Synonyms: | 1-[4-(Dimethylamino)phenyl]-1-propanone;4'-(Dimethylamino)propiophenone;4'-Dimethylaminopropiophenone;1-(4-(diMethylaMino)phenyl)propan-1-one;1-Propanone, 1-[4-(dimethylamino)phenyl]- | | CAS: | 26672-58-2 | | MF: | C11H15NO | | MW: | 177.24 | | EINECS: | | | Product Categories: | | | Mol File: | 26672-58-2.mol |  |
| | 4'-(Dimethylamino)propiophenone Chemical Properties |
| Melting point | 103 °C | | Boiling point | 270-272 °C | | density | 1.010±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.98±0.24(Predicted) | | form | solid | | Appearance | Light yellow to green yellow Solid | | InChI | 1S/C11H15NO/c1-4-11(13)9-5-7-10(8-6-9)12(2)3/h5-8H,4H2,1-3H3 | | InChIKey | ONCICIKBSHQJTB-UHFFFAOYSA-N | | SMILES | CCC(C1=CC=C(N(C)C)C=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 4'-(Dimethylamino)propiophenone Usage And Synthesis |
| | 4'-(Dimethylamino)propiophenone Preparation Products And Raw materials |
|