1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane manufacturers
|
| | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane Basic information |
| Product Name: | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane | | Synonyms: | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane;3-[2-(3-Hydroxyphenyl)ethyl]-5-methoxyphenol;Batatasin III;Batatasin Ⅲ;Phenol, 3-[2-(3-hydroxyphenyl)ethyl]-5-methoxy-;1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane USP/EP/BP;3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol;Focal adhesion kinase,Batatasin III,Inhibitor,inhibit,PTK2 protein tyrosine kinase 2,PKB,FAK,PTK2,Protein kinase B,Akt | | CAS: | 56684-87-8 | | MF: | C15H16O3 | | MW: | 244.29 | | EINECS: | | | Product Categories: | | | Mol File: | 56684-87-8.mol |  |
| | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane Chemical Properties |
| Melting point | 98 °C | | Boiling point | 430.1±35.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | 4°C, away from moisture and light | | form | Solid | | pka | 9.63±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C15H16O3/c1-18-15-9-12(8-14(17)10-15)6-5-11-3-2-4-13(16)7-11/h2-4,7-10,16-17H,5-6H2,1H3 | | InChIKey | VYQXIUVIYICVCM-UHFFFAOYSA-N | | SMILES | C1(O)=CC(OC)=CC(CCC2=CC=CC(O)=C2)=C1 |
| | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane Usage And Synthesis |
| Uses | Batatasin III is an inhibitor isolated from Dioscorea batatas and is also a new dormancy-inducing substance of yam bulbils. | | Definition | ChEBI: Batatasin III is a stilbenoid. |
| | 1-(3-Hydroxy-5-methoxyphenyl)-2-(3-hydroxyphenyl)ethane Preparation Products And Raw materials |
|