- 4-Fluorobenzophenone
-
- $0.00 / 1KG
-
2026-04-28
- CAS:345-83-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100MT/year
- 4-Fluorobenzophenone
-
- $0.00 / 1KG
-
2025-06-27
- CAS:345-83-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | 4-Fluorobenzophenone Basic information |
| | 4-Fluorobenzophenone Chemical Properties |
| Melting point | 47-49 °C (lit.) | | Boiling point | 159-161 °C (13 mmHg) | | density | 1.1871 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Benzene, Hexanes | | form | Crystalline Powder | | color | Light beige | | BRN | 1869800 | | InChI | InChI=1S/C13H9FO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H | | InChIKey | OGTSHGYHILFRHD-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 345-83-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzophenone, 4-fluoro-(345-83-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Fluorobenzophenone Usage And Synthesis |
| Chemical Properties | light beige crystalline powder | | Uses | 4-Fluorobenzophenone is a Wittig reagent. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 58, p. 2492, 1993 DOI: 10.1021/jo00061a024 Synthesis, p. 54, 1977 |
| | 4-Fluorobenzophenone Preparation Products And Raw materials |
|