|
|
| | 1-Benzhydrylazetane-3-carbonitrile Basic information |
| Product Name: | 1-Benzhydrylazetane-3-carbonitrile | | Synonyms: | 1-BENZHYDRYLAZETANE-3-CARBONITRILE;1-BENZHYDRYL-AZETIDINE-3-CARBONITRILE;1-BENZHYDRYL-3-CYANOAZETIDINE;BUTTPARK 37\04-15;3-CYANO-1-(DIPHENYLMETHYL)AZETIDINE;1-BENZHYDRYL-3-CYANOAZETIDINE 98%;1-(diphenylmethyl)azetidine-3-carbonitrile;3-azetidinecarbonitrile, 1-(diphenylmethyl)- | | CAS: | 36476-86-5 | | MF: | C17H16N2 | | MW: | 248.32 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Azetidine;1 | | Mol File: | 36476-86-5.mol |  |
| | 1-Benzhydrylazetane-3-carbonitrile Chemical Properties |
| Melting point | 150-153°C | | Boiling point | 384.3±42.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.61±0.10(Predicted) | | color | White | | Stability: | Good | | InChI | InChI=1S/C17H16N2/c18-11-14-12-19(13-14)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,14,17H,12-13H2 | | InChIKey | IXMOEAHDRKNAAG-UHFFFAOYSA-N | | SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(C#N)C1 | | CAS DataBase Reference | 36476-86-5(CAS DataBase Reference) |
| | 1-Benzhydrylazetane-3-carbonitrile Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A proline analog and proline formation inhibitor | | Synthesis | 1-Diphenylmethyl-3-cyanoazetidine can be prepared from diphenylmethylamine as raw material firstly 1-Diphenylmethyl-3-hydroxyazetidine, then methylsulfonylated to obtain 1-Diphenylmethyl-3-(methylsulfonyloxy)azetidine, and finally reacted with sodium cyanide to obtain 1-Diphenylmethyl-3-cyanoazetidine. |
| | 1-Benzhydrylazetane-3-carbonitrile Preparation Products And Raw materials |
|