DIALLYL N,N-DIISOPROPYLPHOSPHORAMIDITE manufacturers
|
| | DIALLYL N,N-DIISOPROPYLPHOSPHORAMIDITE Chemical Properties |
| Boiling point | 130 °C(lit.) | | density | 0.928 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.456(lit.) | | Fp | 90 °F | | storage temp. | 2-8°C | | pka | 4.96±0.70(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 4383514 | | InChI | InChI=1S/C12H24NO2P/c1-7-9-14-16(15-10-8-2)13(11(3)4)12(5)6/h7-8,11-12H,1-2,9-10H2,3-6H3 | | InChIKey | QBLCHHSGJTUNSJ-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(OCC=C)OCC=C |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 1-10 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | DIALLYL N,N-DIISOPROPYLPHOSPHORAMIDITE Usage And Synthesis |
| Phophorylating Reagent | Diallyl N,N-diisopropylphosphoramidite was employed as a phophorylating reagent. It can be used for reactions involved in phosphitylation of alcohols, deallylation for the synthesis of nucleoside phosphoramidite, posphitylation and stereoselective pudovik rearrangement. It can be used for preparation of peptide substrates, rhodamine dyes with phosphorylated CH2OH sites, and 3-[4-(bis-allyloxy- phosphoryloxy)-2(R)-hydroxy-3,3-dimethyl-butyrylamino]-thiopropionic acid-S-propylester and so on. It also involved in the synthesis of pharmacologically active molecules including selective orally active S1P1 agonists, water-soluble prodrugs of triazole CS-758 with antifungal activity, and fostriecin analogs as antitumor agents, and so on
| | Uses | Precursor involved in the synthesis of pharmacologically active molecules including:• ;Selective orally active S1P1 agonists1• ;Water-soluble prodrugs of triazole CS-758 with antifungal activity2• ;Fostriecin analogs as antitumor agents3Reactant involved in: • ;Phosphitylation of alcohols4• ;Deallylation for the synthesis of nucleoside phosphoramidite5• ;Posphitylation and stereoselective Pudovik rearrangement6 | | Uses | Diallyl N,N-diisopropylphosphoramidite is a reagent used in the synthesis of Leustroducsin B that exhibits large variety of biological activities. It also acts as a reagent in the synthesis of water-soluble prodrugs of triazole CS-758 with antifungal activities. | | Uses | Precursor involved in the synthesis of pharmacologically active molecules including:
- Selective orally active S1P1 agonists
- Water-soluble prodrugs of triazole CS-758 with antifungal activity
- Fostriecin analogs as antitumor agents
Reactant involved in:
- Phosphitylation of alcohols
- Deallylation for the synthesis of nucleoside phosphoramidite
- Posphitylation and stereoselective Pudovik rearrangement
|
| | DIALLYL N,N-DIISOPROPYLPHOSPHORAMIDITE Preparation Products And Raw materials |
|