- Ganoderic acid C2
-
- $55.00 / 1mg
-
2026-04-20
- CAS:103773-62-2
- Min. Order:
- Purity: 99.97%
- Supply Ability: 10g
- Ganoderic acid C2
-
- $0.00 / 5mg
-
2023-02-24
- CAS:103773-62-2
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- GANODERIC ACID C2
-
- $3.00 / 1KG
-
2020-01-18
- CAS:103773-62-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg , 5kg, 50kg
|
| | GANODERIC ACID C2 Basic information |
| Product Name: | GANODERIC ACID C2 | | Synonyms: | GANODERIC ACID C2;(25R)-3β,7β,15α-Trihydroxy-11,23-dioxo-5α-lanost-8-en-26-oic acid;(3beta,7beta,15alpha,25R)-3,7,15-Trihydroxy-11,23-dioxo-lanost-8-en-26-oic acid;Lanost-8-en-26-oicacid, 3,7,15-trihydroxy-11,23-dioxo-, (3b,7b,15a,25R)-;Lanost-8-en-26-oic acid, 3,7,15-trihydroxy-11,23-dioxo-, (3β,7β,15α,25R)-;Ganoderic acid C-2,Inhibitor,Ganoderic acid C 2,Ganoderic acid C2,inhibit;(2R,6R)-2-Methyl-4-oxo-6-((3S,5R,7S,10S,13R,14R,15S,17R)-3,7,15-trihydroxy-4,4,10,13,14-pentamethyl-11-oxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)heptanoic acid;Ganoderic acid C2, 10 mM in DMSO | | CAS: | 103773-62-2 | | MF: | C30H46O7 | | MW: | 518.68 | | EINECS: | | | Product Categories: | | | Mol File: | 103773-62-2.mol |  |
| | GANODERIC ACID C2 Chemical Properties |
| Melting point | 231～232℃ | | Boiling point | 690.8±55.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.78±0.23(Predicted) | | form | Powder | | color | White to off-white | | InChIKey | RERVSJVGWKIGTJ-NGLNAJFRNA-N | | SMILES | [C@@]12(C)[C@@H](O)C[C@H]([C@H](C)CC(=O)C[C@@H](C)C(=O)O)[C@@]1(C)CC(=O)C1[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])C[C@H](O)C2=1 |&1:0,2,5,6,12,17,23,27,32,35,r| |
| | GANODERIC ACID C2 Usage And Synthesis |
| Uses | Ganoderic Acid D, is a new lanostanoid triterpene extracted from the fruit bodies of Ganoderma Lucidum mushroom. these compounds are shown to possess many therapeutic properties. They can be used as anti-virus, anti-inflammation, anti-tumor, immunity-promoting, anti-diabetic, etc. | | Definition | ChEBI: Ganoderic acid C2 is a triterpenoid. |
| | GANODERIC ACID C2 Preparation Products And Raw materials |
|