| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
L-LYSINE 2HCL (U-13C6, 15N2) manufacturers
|
| | L-LYSINE 2HCL (U-13C6, 15N2) Basic information |
| Product Name: | L-LYSINE 2HCL (U-13C6, 15N2) | | Synonyms: | L-LYSINE 2HCL (U-13C6, 15N2);L-LYSINE-13C6,15N2 HYDROCHLORIDE;(S)-2,6-Diaminohexanoic acid-13C6,15N2 hydrochloride;13C and 15N Labeled Lys;13C and 15N Labeled lysine hydrochloride;L-Lysine-13C6,15N2 hydrochloride 99 atom % 13C, 99 atom % 15N, 95% (CP);"L-Lysine-13C6,15N2.HCl";L-Lysine-13C?,1?N? hydrochloride | | CAS: | 1200447-00-2 | | MF: | C6H15ClN2O2 | | MW: | 190.72 | | EINECS: | | | Product Categories: | Alphabetical Listings;Amino Acids;Amino Acids and DerivativesStable Isotopes;Amino AcidsStable Isotopes;Biomolecular MS;Biomolecular NMR;I-LStable Isotopes;Metabolic Labeling ProductsStable Isotopes;Products for SILAC;Stable Isotopes | | Mol File: | Mol File |  |
| | L-LYSINE 2HCL (U-13C6, 15N2) Chemical Properties |
| Melting point | 263-264 °C (dec. )(lit.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Aqueous Acid (Slightly, Sonicated), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +20.7°, c = 2 in 5 M HCl | | InChI | 1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1; | | InChIKey | BVHLGVCQOALMSV-GSMNGUNQSA-N | | SMILES | Cl.[15NH2][13CH2][13CH2][13CH2][13CH2][13C@H]([15NH2])[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-LYSINE 2HCL (U-13C6, 15N2) Usage And Synthesis |
| Uses | Pulsed Stable Isotope labeling of amino acid has been used to study host-cell function, survival, the precise intracellular pathways in protein synthesis of HIV-1 infected human monocytederived macrophages. | | General Description | Lysine is a basic ketogenic amino acid with a protonated alkyl amino group. Lysine degradation results in the formation of acetoacetate. Acetylation/deacetylation of lysine residues in histones is a mechanism to regulate chromatin organization in eukaryotes. Isotope labeled amino acids are required for the production of isotopically labeled proteins. |
| | L-LYSINE 2HCL (U-13C6, 15N2) Preparation Products And Raw materials |
|