|
|
| | 4-((2-Chloroethyl)(methyl)amino)benzaldehyde Basic information |
| Product Name: | 4-((2-Chloroethyl)(methyl)amino)benzaldehyde | | Synonyms: | 4-[(2-chloroethyl)methylamino]-benzaldehyd;p-[(2-chloroethyl)methylamino]benzaldehyde;N-Methyl-N-Chloroethyl-p-Amino Benzaldehyde;N-Methyl-N-Chloroethyl-4-Amino Benzaldehyde;p-N-(Methyl-N-2-Chloro Ethyl) Amino Benzaldehyde;4-(N-(2-Chloroethyl)-N-Methyl)Aminobenzaldehyde;(3R,4R)-3-Ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one nitric acid;2(3H)-Furanone, 3-ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-, (3R-trans)-, mononitrate | | CAS: | 94-31-5 | | MF: | C10H12ClNO | | MW: | 197.66 | | EINECS: | 202-321-3 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 94-31-5.mol |  |
| | 4-((2-Chloroethyl)(methyl)amino)benzaldehyde Chemical Properties |
| Melting point | 70 °C | | Boiling point | 328.7±27.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 1.47±0.50(Predicted) | | Appearance | Off-white to light green Solid | | InChI | InChI=1S/C10H12ClNO/c1-12(7-6-11)10-4-2-9(8-13)3-5-10/h2-5,8H,6-7H2,1H3 | | InChIKey | IYFULQJDHJGQKQ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N(CCCl)C)C=C1 | | CAS DataBase Reference | 94-31-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzaldehyde, 4-[(2-chloroethyl)methylamino]- (94-31-5) |
| TSCA | TSCA listed | | HS Code | 2922390090 |
| | 4-((2-Chloroethyl)(methyl)amino)benzaldehyde Usage And Synthesis |
| | 4-((2-Chloroethyl)(methyl)amino)benzaldehyde Preparation Products And Raw materials |
|