|
|
| | (S)-(-)-2-(1-HYDROXYETHYL)PYRIDINE Basic information |
| | (S)-(-)-2-(1-HYDROXYETHYL)PYRIDINE Chemical Properties |
| Melting point | 29°C(lit.) | | Boiling point | 95-98 °C(Press: 12 Torr) | | density | 1.082±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.528 | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in toluene. | | form | Solid | | pka | 13.55±0.20(Predicted) | | color | Colorless | | InChI | InChI=1/C7H9NO/c1-6(9)7-4-2-3-5-8-7/h2-6,9H,1H3/t6-/s3 | | InChIKey | PPHIIIRFJKDTLG-ISZMHOAENA-N | | SMILES | [C@H](C1N=CC=CC=1)(O)C |&1:0,r| |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | HS Code | 29339900 |
| | (S)-(-)-2-(1-HYDROXYETHYL)PYRIDINE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid or solid | | Uses | (S)-1-(Pyridin-2-yl)ethanol is used in the synthesis of Kynurenine 3-monooxygenase inhibitors used in pancreatitis treatments. |
| | (S)-(-)-2-(1-HYDROXYETHYL)PYRIDINE Preparation Products And Raw materials |
|