L-CYSTEIC ACID MONOHYDRATE manufacturers
|
| | L-CYSTEIC ACID MONOHYDRATE Basic information |
| | L-CYSTEIC ACID MONOHYDRATE Chemical Properties |
| Melting point | 267 °C (dec.)(lit.) | | storage temp. | Room Temperature | | solubility | H2O: soluble | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +7.5±0.5°, c = 5% in H2O | | Water Solubility | Soluble in water. | | Merck | 14,2780 | | BRN | 1725495 | | Stability: | Stable. Combustible. | | Major Application | peptide synthesis | | InChI | 1S/C3H7NO5S.H2O/c4-2(3(5)6)1-10(7,8)9;/h2H,1,4H2,(H,5,6)(H,7,8,9);1H2/t2-;/m0./s1 | | InChIKey | PCPIXZZGBZWHJO-DKWTVANSSA-N | | SMILES | [H]O[H].N[C@@H](CS(O)(=O)=O)C(O)=O | | CAS DataBase Reference | 23537-25-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29379000 | | Storage Class | 11 - Combustible Solids |
| | L-CYSTEIC ACID MONOHYDRATE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | A major metabolite of non-essential amino acid L-Cysteine. | | Uses | Internal standard for amino acid analysis. | | Biochem/physiol Actions | L-cysteic acid is an oxidation product of L-cysteine. L-Cysteic acid, an analogue of cysteine sulfinic acid, may be used in studies of excitatory amino acids in the brain, such as those that bind to cysteine sulfinic acid receptors. L-Cysteic acid is a useful agonist at several rat metabotropic glutamate receptors (mGluRs). | | Purification Methods | Likely impurities are cystine and oxides of cysteine. Crystallise it from water by adding 2 volumes of EtOH. When recrystallised from aqueous MeOH it has m 264-266o, and the anhydrous acid has m ~260o(dec). [Chapeville & Formageot Biochim Biophys Acta 26 538 1957, Riordan & Giese Methods Enzymol 47 31 1977, Beilstein 4 IV 3296.] |
| | L-CYSTEIC ACID MONOHYDRATE Preparation Products And Raw materials |
|