| Company Name: |
Zhengzhou Alfachem Co., Ltd. Gold
|
| Tel: |
0371-53765687 18937137882 |
| Email: |
2853979813@qq.com |
| Products Intro: |
Product Name:3,4-Dichlorothiophene CAS:17249-76-2 Purity:98% Package:1瓶
|
|
| | 3,4-Dichlorothiophene Basic information | | Uses |
| | 3,4-Dichlorothiophene Chemical Properties |
| Melting point | 1°C | | Boiling point | 185°C | | density | 1.487 | | refractive index | 1.5821 | | storage temp. | 2-8°C(protect from light) | | form | liquid | | InChI | InChI=1S/C4H2Cl2S/c5-3-1-7-2-4(3)6/h1-2H | | InChIKey | QVFXSOFIEKYPOE-UHFFFAOYSA-N | | SMILES | C1SC=C(Cl)C=1Cl |
| | 3,4-Dichlorothiophene Usage And Synthesis |
| Uses | 3,4-dichlorothiophene is a useful research chemical. |
| | 3,4-Dichlorothiophene Preparation Products And Raw materials |
|