- N-Ac-L-Tyr-Oet
-
- $1.00 / 1g
-
2020-01-06
- CAS:36546-50-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Ethyl N-acetyl-L-tyrosinate hydrate Basic information |
| Product Name: | Ethyl N-acetyl-L-tyrosinate hydrate | | Synonyms: | N-ACETYL-L-TYROSINE ETHYL ESTE&;Acetyl-L-tyrosine ethyl ester hydrate99%;N-Acetyl-L-tyrosine ethyleester monohydrate;ATEE;ATEE MONOHYDRATE;AC-TYR-OET H2O;ACETYL-L-TYROSINE ETHYL ESTER HYDRATE;ACETYL-L-TYROSINE ETHYL ESTER MONOHYDRATE | | CAS: | 36546-50-6 | | MF: | C13H19NO5 | | MW: | 269.29 | | EINECS: | 212-663-5 | | Product Categories: | Amino Acids | | Mol File: | 36546-50-6.mol |  |
| | Ethyl N-acetyl-L-tyrosinate hydrate Chemical Properties |
| Melting point | 80-81 °C(lit.) | | storage temp. | -20°C | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | White | | Optical Rotation | Consistent with structure | | Sensitive | Hygroscopic | | BRN | 2217900 | | InChI | 1S/C13H17NO4/c1-3-18-13(17)12(14-9(2)15)8-10-4-6-11(16)7-5-10/h4-7,12,16H,3,8H2,1-2H3,(H,14,15)/t12-/m0/s1 | | InChIKey | YIVZYFDBEPMPNL-LBPRGKRZSA-N | | SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O | | CAS DataBase Reference | 36546-50-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | F | 10-21 | | TSCA | Yes | | HS Code | 29242995 | | Storage Class | 11 - Combustible Solids |
| | Ethyl N-acetyl-L-tyrosinate hydrate Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | N-Acetyl-L-tyrosine ethyl ester monohydrate has been used:
- as a substrate in transesterification reactions with 1 M propan-1-ol catalyzed by Carlsberg protease protein-coated microcrystals?(PCMC)
- to test the performance of subtilisin Carlsberg protein-coated microcrystals (PCMC)
- as a substrate for cross-linked crystals (CLECs) of subtilisin activity screening
| | Definition | ChEBI: ATEE is a tyrosine derivative. | | Biochem/physiol Actions | N-Acetyl-L-tyrosine ethyl ester is an N-terminal and C-terminal protected L-tyrosine that is used in crosslinking studies and as a substrate for the detection, differentiation and/or characterization various proteases and esterases. |
| | Ethyl N-acetyl-L-tyrosinate hydrate Preparation Products And Raw materials |
|