2-Chloro-N-(2-methylphenyl)acetamide manufacturers
|
| | 2-Chloro-N-(2-methylphenyl)acetamide Basic information |
| Product Name: | 2-Chloro-N-(2-methylphenyl)acetamide | | Synonyms: | ART-CHEM-BB B015629;CHEMBRDG-BB 3015629;AKOS BBS-00004053;AKOS B015629;2-CHLORO-N-O-TOLYL-ACETAMIDE;2-chloro-N-(2-methylphenyl)acetamide(SALTDATA: FREE);2-CHLORO-ORTHO-ACETOTOLUIDIDE;2-chloro-N-(2-methylphenyl)ethanamide | | CAS: | 37394-93-7 | | MF: | C9H10ClNO | | MW: | 183.63 | | EINECS: | | | Product Categories: | | | Mol File: | 37394-93-7.mol |  |
| | 2-Chloro-N-(2-methylphenyl)acetamide Chemical Properties |
| Melting point | 111-112 °C | | Boiling point | 326.0±25.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 12.90±0.70(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C9H10ClNO/c1-7-4-2-3-5-8(7)11-9(12)6-10/h2-5H,6H2,1H3,(H,11,12) | | InChIKey | LPMANECYGPQBOX-UHFFFAOYSA-N | | SMILES | C(NC1=CC=CC=C1C)(=O)CCl |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 2-Chloro-N-(2-methylphenyl)acetamide Usage And Synthesis |
| | 2-Chloro-N-(2-methylphenyl)acetamide Preparation Products And Raw materials |
|