Mono-Fmoc ethylene diamine hydrochloride manufacturers
|
| | Mono-Fmoc ethylene diamine hydrochloride Basic information |
| Product Name: | Mono-Fmoc ethylene diamine hydrochloride | | Synonyms: | N-FMOC-ETHYLENEDIAMINE HYDROCHLORIDE;N-(2-Aminoethyl)carbamic acid 9H-fluoren-9-ylmethyl ester hydrochloride;N-FMoc-ethylenediaMine HCl;(9H-fluoren-9-yl)methyl N-(2-aminoethyl)carbamate hydrochloride;Carbamic acid, N-(2-aminoethyl)-, 9H-fluoren-9-ylmethylester, hydrochloride (1:1);N-(9-Fluorenylmethoxycarbonyl)-1,2-diaminoethane hydrochloride;(9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate HCI;(9H-FLUOREN-9-YL)METHYL (2-AMINOETHYL)CARBAMATE.HCl | | CAS: | 391624-46-7 | | MF: | C17H19ClN2O2 | | MW: | 318.8 | | EINECS: | | | Product Categories: | | | Mol File: | 391624-46-7.mol |  |
| | Mono-Fmoc ethylene diamine hydrochloride Chemical Properties |
| Melting point | 214-219 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C17H18N2O2.ClH/c18-9-10-19-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16;/h1-8,16H,9-11,18H2,(H,19,20);1H | | InChIKey | UURYASDYOGIDRX-UHFFFAOYSA-N | | SMILES | Cl.N(CCN)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Mono-Fmoc ethylene diamine hydrochloride Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reagent type: spacer |
| | Mono-Fmoc ethylene diamine hydrochloride Preparation Products And Raw materials |
|