4-fluoro-7-hydroxy-1-indanone manufacturers
|
| | 4-fluoro-7-hydroxy-1-indanone Basic information |
| Product Name: | 4-fluoro-7-hydroxy-1-indanone | | Synonyms: | 4-FLUORO-7-HYDROXY-1-INDANONE;4-FLUORO-7-HYDROXYINDAN-1-ONE;4-Fluoro-2,3-dihydro-7-hydroxy-1H-inden-1-one;1H-Inden-1-one, 4-fluoro-2,3-dihydro-7-hydroxy-;4-FLUORO-7-HYDROXY-2,3-DIHYDRO-1H-INDEN-1-ONE(WXC05104);4-fluoro-7-hydroxy-2,3-dihydroinden-1-one;4-fluoro-;4-fluoro-7-hydroxy-2,3-dihydro-1H-inden-1-one | | CAS: | 136191-16-7 | | MF: | C9H7FO2 | | MW: | 166.15 | | EINECS: | | | Product Categories: | | | Mol File: | 136191-16-7.mol |  |
| | 4-fluoro-7-hydroxy-1-indanone Chemical Properties |
| Boiling point | 335.2±42.0 °C(Predicted) | | density | 1.412 | | storage temp. | Storage temp. 2-8°C | | pka | 10.30±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H7FO2/c10-6-2-4-8(12)9-5(6)1-3-7(9)11/h2,4,12H,1,3H2 | | InChIKey | SCUZCYGMCGKOPP-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(F)=CC=C2O)CC1 |
| Hazard Codes | Xn | | Risk Statements | 22 |
| | 4-fluoro-7-hydroxy-1-indanone Usage And Synthesis |
| Uses | 4-fluoro-7-hydroxy-1-indanone can be used as an intermediate in organic syntheses. | | Preparation | The raw material compound was mixed with aluminum chloride and then the reaction was heated to 100 °C. After 15 minutes, heat the reactants to 180 °C. Cool the mixture to room temperature after 3 h. Add ethyl acetate to the reaction solution and stir for 2 h. The resulting organic phase is dried on anhydrous sodium sulfate and concentrated under reduced pressure. After purification, 4-fluoro-7-hydroxy-1-indanone was obtained.
 |
| | 4-fluoro-7-hydroxy-1-indanone Preparation Products And Raw materials |
|