(R)-(+)-N,ALPHA-DIMETHYLBENZYLAMINE manufacturers
|
| | (R)-(+)-N,ALPHA-DIMETHYLBENZYLAMINE Basic information |
| | (R)-(+)-N,ALPHA-DIMETHYLBENZYLAMINE Chemical Properties |
| Melting point | 116°C (estimate) | | Boiling point | 74-76 °C/11 mmHg (lit.) | | density | 0.924 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.511(lit.) | | Fp | 143 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.77±0.10(Predicted) | | form | Liquid | | color | Clear colorless | | Optical Rotation | [α]20/D +70°, c = 2 in chloroform | | BRN | 4350160 | | InChI | InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/s3 | | InChIKey | RCSSHZGQHHEHPZ-MRVPVSSYSA-N | | SMILES | N(C)[C@H](C)C1=CC=CC=C1 |&1:2,r| | | CAS DataBase Reference | 5933-40-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2619 8/PG 2 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29214900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| | (R)-(+)-N,ALPHA-DIMETHYLBENZYLAMINE Usage And Synthesis |
| Uses | Used to make asymmetric organometallic catalysts (e.g., for conjugate additions to enones). |
| | (R)-(+)-N,ALPHA-DIMETHYLBENZYLAMINE Preparation Products And Raw materials |
|