- D-Homophenylalanine
-
- $0.00 / 100g
-
2026-02-13
- CAS:82795-51-5
- Min. Order: 100g
- Purity: 98%min
- Supply Ability: 500kg
- D-Homophe-OH
-
- $0.00/ kg
-
2026-02-02
- CAS:82795-51-5
- Min. Order: 1kg
- Purity: 98% 99%
- Supply Ability: 1T+
|
| | D-Homophenylalanine Basic information |
| | D-Homophenylalanine Chemical Properties |
| Melting point | >300 °C (lit.) | | alpha | -45 º (c=1, 3N HCl 19 ºC) | | Boiling point | 311.75°C (rough estimate) | | density | 1.1248 (rough estimate) | | refractive index | -45 ° (C=1, 3mol/L HCl) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Sparingly), Aqueous Base (Slightly) | | pka | 2.32±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D -45±1°, c =1% in 3 M HCl | | BRN | 4675530 | | Major Application | peptide synthesis | | InChI | InChI=1/C10H13NO2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/s3 | | InChIKey | JTTHKOPSMAVJFE-DJEYLCQNNA-N | | SMILES | C(C1C=CC=CC=1)C[C@@H](N)C(=O)O |&1:8,r| | | CAS DataBase Reference | 82795-51-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | D-Homophenylalanine Usage And Synthesis |
| Chemical Properties | BEIGE POWDER | | Uses | D-Homophenylalanine is used in peptide synthesis as an amino acid protection monomer. | | Preparation | Synthesis of D-Homophenylalanine: To obtain D-homophenylalanine in high yield by treating 5- benzylmethylhydantoin with a microorganism belonging to the genus Pseudomonas or a 5-hydantoin decomposition-type enzyme derived from the microorganism. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D-Homophenylalanine Preparation Products And Raw materials |
|