| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:cFMS Receptor Inhibitor IV
CAS:959626-45-0
Purity:>=98% Package:25mg Remarks:S23521
|
| Company Name: |
Tianjin Kailiqi Biotechnology Co., Ltd.
|
| Tel: |
15076683720 |
| Email: |
klq@cw-bio.com |
| Products Intro: |
CAS:959626-45-0
Purity:≥98% Package:1g,5g,10g,25g根据客户需要分装 Remarks:Not For Human Use, Lab Use Only.
|
| Company Name: |
Zhejiang Huida Biotech Co., LTD
|
| Tel: |
0571-89903022 18679456698 |
| Email: |
zilong@hizyme.com |
| Products Intro: |
Product Name:cFMS Receptor Inhibitor IV
CAS:959626-45-0
Purity:>=98% Package:100mg；200mg
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-1647117 13681763483 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:5-Cyano-N-(2,5-di(piperidin-1-yl)phenyl)furan-2-carboxamide
CAS:959626-45-0
Purity:95% Package:10mg;25mg;50mg;100mg;250mg Remarks:BD01386339
|
|
| | OTAVA-BB 7070707032 Basic information |
| Product Name: | OTAVA-BB 7070707032 | | Synonyms: | OTAVA-BB 7070707032;cFMS Receptor Inhibitor IV;5-cyano-N-[2,5-di(piperidin-1-yl)phenyl]furan-2-carboxamide;2-Furancarboxamide, 5-cyano-N-(2,5-di-1-piperidinylphenyl)-;cFMS Receptor Inhibitor IV, 10 mM in DMSO | | CAS: | 959626-45-0 | | MF: | C22H26N4O2 | | MW: | 378.47 | | EINECS: | | | Product Categories: | | | Mol File: | 959626-45-0.mol |  |
| | OTAVA-BB 7070707032 Chemical Properties |
| Boiling point | 530.5±50.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 31.25 mg/mL (82.57 mM; ultrasonic and warming and heat to 60°C) | | pka | 10.55±0.70(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | 1S/C22H26N4O2/c23-16-18-8-10-21(28-18)22(27)24-19-15-17(25-11-3-1-4-12-25)7-9-20(19)26-13-5-2-6-14-26/h7-10,15H,1-6,11-14H2,(H,24,27) | | InChIKey | FQGXFVDABCBEFW-UHFFFAOYSA-N | | SMILES | N4(CCCCC4)c1c(cc(cc1)N3CCCCC3)NC(=O)c2[o]c(cc2)C#N |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | OTAVA-BB 7070707032 Usage And Synthesis |
| Uses | cFMS Receptor Inhibitor IV (Compound 42) is a potent cFMS inhibitor with an IC50 of 0.017 μM[1]. | | References | [1] Patch RJ, et al. Potent 2'-aminoanilide inhibitors of cFMS as potential anti-inflammatory agents. Bioorg Med Chem Lett. 2007 Nov 15;17(22):6070-4. DOI:10.1016/j.bmcl.2007.09.057 |
| | OTAVA-BB 7070707032 Preparation Products And Raw materials |
|