| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
N-ethylpyridinium tetrafluoroborate manufacturers
|
| | N-ethylpyridinium tetrafluoroborate Basic information |
| | N-ethylpyridinium tetrafluoroborate Chemical Properties |
| Melting point | 58.5-59.5 °C | | storage temp. | RT, stored under nitrogen | | form | crystals | | Appearance | White to off-white Solid | | BRN | 4048977 | | InChI | 1S/C7H10N.BF4/c1-2-8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,2H2,1H3;/q+1;-1 | | InChIKey | JAKIITPDQKZZMZ-UHFFFAOYSA-N | | SMILES | F[B-](F)(F)F.CC[n+]1ccccc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-ethylpyridinium tetrafluoroborate Usage And Synthesis |
| Uses | 1-Ethylpyridinium tetrafluoroborate [EPy][BF4} is an ionic liquid that can be used as:
- A reaction medium in the Morita-Baylis-Hillman (MBH) reactions of acrylonitrile with 4-nitrobenzaldehyde to yield MBH adducts.
- A solvent in the Diels-Alder reactionsof isoprenewith dienophiles.
- A component of a binary mixture, which is employed in the solute-solvent interaction studies using vitamins like nicotinic acid and ascorbic acid.
|
| | N-ethylpyridinium tetrafluoroborate Preparation Products And Raw materials |
|