|
|
| | 3,4'-Dihexyl-2,2'-bithiophene Basic information |
| Product Name: | 3,4'-Dihexyl-2,2'-bithiophene | | Synonyms: | 3,4'-Dihexyl-2,2'-bithiophene;3,4'-Dihexyl-2,2'-bithiophene>;2,2'-Bithiophene, 3,4'-dihexyl-;3,4'-Dihexyl-2,2'-bithiophene ISO 9001：2015 REACH;3,4′-Dihexyl-2,2′-bithiophene, CAS 135926-93-1 | | CAS: | 135926-93-1 | | MF: | C20H30S2 | | MW: | 334.58 | | EINECS: | | | Product Categories: | | | Mol File: | 135926-93-1.mol |  |
| | 3,4'-Dihexyl-2,2'-bithiophene Chemical Properties |
| Boiling point | 165°C/0.02mmHg | | density | 1.009±0.06 g/cm3(Predicted) | | refractive index | 1.5510-1.5550 | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | White to Amber to Dark green | | λmax | 297nm(CHCl3)(lit.) | | InChI | InChI=1S/C20H30S2/c1-3-5-7-9-11-17-15-19(22-16-17)20-18(13-14-21-20)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3 | | InChIKey | FWQMKAFKIYUBKB-UHFFFAOYSA-N | | SMILES | C1(C2SC=C(CCCCCC)C=2)SC=CC=1CCCCCC |
| | 3,4'-Dihexyl-2,2'-bithiophene Usage And Synthesis |
| | 3,4'-Dihexyl-2,2'-bithiophene Preparation Products And Raw materials |
|