(-)-Benzotetramisole manufacturers
- (-)-Benzotetramisole
-
- $82.00 / 1mg
-
2026-04-27
- CAS:950194-37-3
- Min. Order:
- Purity: 98.70%
- Supply Ability: 10g
|
| | (-)-Benzotetramisole Basic information |
| Product Name: | (-)-Benzotetramisole | | Synonyms: | (-)-BTM
(2S)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole;(2S)-2,3-Dihydro-2-phenyliMidazo[2,1-b]benzothiazole;(S)-Benzotetramisole;(S)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole;Imidazo[2,1-b]benzothiazole, 2,3-dihydro-2-phenyl-, (2S)-;(2S)-2-Phenyl-2,3-dihydroimidazo[2,1-b][1,3]benzothiazole 98+%;(-)-Benzotetramisole >;(-)-Benzotetramisole | | CAS: | 950194-37-3 | | MF: | C15H12N2S | | MW: | 252.33 | | EINECS: | | | Product Categories: | | | Mol File: | 950194-37-3.mol |  |
| | (-)-Benzotetramisole Chemical Properties |
| Melting point | 93.0 to 97.0 °C | | Boiling point | 428.1±48.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.53±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C15H12N2S/c1-2-6-11(7-3-1)12-10-17-13-8-4-5-9-14(13)18-15(17)16-12/h1-9,12H,10H2/t12-/m1/s1 | | InChIKey | YGCWPCVAVSIFLO-GFCCVEGCSA-N | | SMILES | S1C2=CC=CC=C2N2C[C@H](C3=CC=CC=C3)N=C12 | | CAS DataBase Reference | 950194-37-3 |
| | (-)-Benzotetramisole Usage And Synthesis |
| | (-)-Benzotetramisole Preparation Products And Raw materials |
|