- 8-Bromo-7-quinolinol
-
- $3.00 / 1KG
-
2019-07-06
- CAS:90224-71-8
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 1000kg
|
| | 8-Bromo-7-quinolinol Basic information |
| Product Name: | 8-Bromo-7-quinolinol | | Synonyms: | 8-Bromo-7-quinolinol;8-Bromo-7-hydroxyquinoline;7-Hydroxy-8-bromo-quinoline;8-broMoquinolin-7-ol;7-Quinolinol, 8-bromo-;8-Bromo-7-quinolinol ISO 9001：2015 REACH | | CAS: | 90224-71-8 | | MF: | C9H6BrNO | | MW: | 224.05 | | EINECS: | | | Product Categories: | | | Mol File: | 90224-71-8.mol |  |
| | 8-Bromo-7-quinolinol Chemical Properties |
| Melting point | 196-198℃ | | density | 1.705 | | storage temp. | 2-8°C | | form | powder | | color | light brown | | InChI | InChI=1S/C9H6BrNO/c10-8-7(12)4-3-6-2-1-5-11-9(6)8/h1-5,12H | | InChIKey | ACQSKLVTXZNXGL-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(O)C=2Br)C=CC=1 |
| | 8-Bromo-7-quinolinol Usage And Synthesis |
| Synthesis | Step 2: Synthesis of 8-bromo-7-hydroxyquinoline
A solution of bromine (22.9 mL, 0.444 mol) in acetic acid (120 mL) was slowly added dropwise to a stirred mixture of 7-hydroxyquinoline (59.0 g, 0.406 mol) in acetic acid (120 mL) and dichloromethane (240 mL), and the internal temperature of the reaction system was controlled to be at 0-5 °C. The resulting suspension was continued to be stirred at 0-5 °C for 2 h. Upon completion of the reaction, it was diluted with ethyl acetate (100 mL) and filtered. The solid product was collected, washed with ethyl acetate (2 x 20 mL) and subsequently dried under vacuum to afford 8-bromo-7-hydroxyquinoline (65 g, 76% yield). | | References | [1] Patent: WO2010/54006, 2010, A1. Location in patent: Page/Page column 52-53
[2] Yakugaku Zasshi, 1955, vol. 75, p. 28
[3] Chem.Abstr., 1956, p. 1021 |
| | 8-Bromo-7-quinolinol Preparation Products And Raw materials |
|