|
|
| | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex Basic information |
| Product Name: | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex | | Synonyms: | Dichloro(2,2,6,6-tetramethylpiperidinato)magnesate(1-) lithium (1:1);2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex solution;2,2,6,6-TetraMethylpiperidinylMagnesiuM chloride lithiuM chloride coMplex solution 1.0 M in THF/toluene;2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex;piperidinyL;Magnesate(1-), dichloro(2,2,6,6-tetramethylpiperidinato)-, lithium (1:1);lithium,magnesium,2,2,6,6-tetramethylpiperidin-1-ide,dichloride;Dichloro(2,2,6,6-tetramethylpiperidinato)magnesate(1-) lithium | | CAS: | 898838-07-8 | | MF: | C9H18Cl2LiMgN | | MW: | 242.4 | | EINECS: | | | Product Categories: | Chemical Synthesis;Grignard Reagents;Heteroaryl;Organometallic Reagents | | Mol File: | 898838-07-8.mol |  |
| | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex Chemical Properties |
| Boiling point | 66°/759.8mm | | density | 0.96g/mLat 25℃ | | Fp | -15°C | | storage temp. | 2-8°C | | form | liquid | | InChI | InChI=1S/C9H18N.2ClH.Li.Mg/c1-8(2)6-5-7-9(3,4)10-8;;;;/h5-7H2,1-4H3;2*1H;;/q-1;;;+1;+2/p-2 | | InChIKey | JHBZAAACZVPPRQ-UHFFFAOYSA-L | | SMILES | [Mg+2]([N-]1C(CCCC1(C)C)(C)C)([Cl-])[Cl-].[Li+] |
| Hazard Codes | F,C | | Risk Statements | 63-11-14-19-34-37-40 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 3399 4.3/PG 1 | | WGK Germany | 3 | | HazardClass | 3, 8 | | HS Code | 29333990 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Carc. 2
Eye Dam. 1
Flam. Liq. 2
Repr. 2
Skin Corr. 1B
STOT SE 3 |
| | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex Usage And Synthesis |
| Uses | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex deprotonations using Knochel-Hauser-Base | | Uses | 2,2,6,6-Tetramethylpiperidinylmagnesium Chloride Lithium Chloride Complex is used in preparation of Pyridazinones as herbicides. Also, used in preparation of MCL-1 inhibitors useful for treatment of cancer. | | Uses | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex is a non-nucleophilic Knochel-Hauser base mainly used for the magnesiation of functionalized arenes and heteroarenes to prepare the corresponding Grignard reagents. It can also be used as a base in the synthesis of Π-conjugated polymers via catalyst-transfer polycondensation. | | reaction suitability | reaction type: Grignard Reaction | | Synthesis | A 1000-ml triple-necked flask was taken, and the reaction flask was replaced three times with argon, and a little argon was turned on after the replacement so that the triple-necked flask was in an argon atmosphere, and then anhydrous lithium chloride (42.4 g,
(1 mol), 2,2,6,6-tetramethylpiperidine (141.3 g, 1 mol), and 1,10-phenanthroline (0.54 g, 3 mmol) were then added to the triplex, and 150 mL of tetrahydrofuran was added, and the temperature was controlled to 0-5 C, and the mixture was stirred for 10 min, then a dropwise concentration of was added.
Degree of 2.0 M of isopropylmagnesium chloride of tetrahydrofuran solution (500 mL, 1 mol), dropwise addition process to control the temperature does not exceed 10 C. After the dropwise addition is completed, increase the temperature to 20-25 C, and continue to stir for 8 hours, the reaction is completed, the holding at room temperature to settle for about 2 hours, filtered through a sand plate funnel, and washed by the tetrahydrofuran, to obtain the concentration of 1.3 M of magnesium dichloride (2,2,6,6 -tetramethylpiperidine) lithium salt of tetrahydrofuran solution 692mL (90% yield). |
| | 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex Preparation Products And Raw materials |
|