1-(2-Bromophenyl)-cyclobutanecarbonitrile manufacturers
|
| | 1-(2-Bromophenyl)-cyclobutanecarbonitrile Basic information |
| Product Name: | 1-(2-Bromophenyl)-cyclobutanecarbonitrile | | Synonyms: | 1-(2-Bromophenyl)-cyclobutanecarbonitrile;Cyclobutanecarbonitrile, 1-(2-broMophenyl)-;1-(2-Bromophenyl)cyclobutane-1-carbonitrile;1-(2-Bromophenyl)cyclobutane-1-carbonitrile - [B92669];1-(2-bromophenyl)cyclobutanemethylnitrile | | CAS: | 28049-62-9 | | MF: | C11H10BrN | | MW: | 236.11 | | EINECS: | | | Product Categories: | | | Mol File: | 28049-62-9.mol |  |
| | 1-(2-Bromophenyl)-cyclobutanecarbonitrile Chemical Properties |
| storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10BrN/c12-10-5-2-1-4-9(10)11(8-13)6-3-7-11/h1-2,4-5H,3,6-7H2 | | InChIKey | WQNBUMDTSAQSMG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2Br)(C#N)CCC1 |
| | 1-(2-Bromophenyl)-cyclobutanecarbonitrile Usage And Synthesis |
| | 1-(2-Bromophenyl)-cyclobutanecarbonitrile Preparation Products And Raw materials |
|