|
|
| | 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine Basic information | | Uses |
| Product Name: | 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine | | Synonyms: | EOS-61162;8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine;8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine;2-AMino-8-broMo[1,2,4]triazolo[1,5-a]pyridine;8-bromo - [1,2,4] thiazolo [1,5-a] pyridine-2-amine;106347;[1,2,4]Triazolo[1,5-a]pyridin-2-amine, 8-bromo-;8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine | | CAS: | 1124382-72-4 | | MF: | C6H5BrN4 | | MW: | 213.03 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 1124382-72-4.mol | ![8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine Structure](CAS2/GIF/1124382-72-4.gif) |
| | 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine Chemical Properties |
| density | 2.09 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.83±0.30(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5BrN4/c7-4-2-1-3-11-5(4)9-6(8)10-11/h1-3H,(H2,8,10) | | InChIKey | SUFKKFLJJMKVJJ-UHFFFAOYSA-N | | SMILES | C12=NC(N)=NN1C=CC=C2Br |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine Usage And Synthesis |
| Uses | 8-Bromo-[1,2,4]thiazo[1,5-a]pyridine-2-amine is a pyridine derivative that can be used as a pharmaceutical synthesis intermediate for pharmaceutical synthesis and experimental research. | | Synthesis | The general procedure for the synthesis of 2-amino-8-bromo[1,2,4]triazolo[1,5-a]pyridine from compound (CAS:1124383-00-1) is as follows:
1. Dissolution step: Methanol (MeOH, 300 mL), hydroxylamine hydrochloride (62.83 g, 904 mmol) and diisopropylethylamine (DIPEA, 694 mL, 543 mmol) were added to a solution of Intermediate 50 (55 g, 181 mmol) in ethanol (EtOH, 300 mL).
2. Reaction step: the reaction mixture was stirred at room temperature (r.t.) for 6 hours.
3. Post-treatment step: the reaction mixture was concentrated in vacuum and the residue was suspended in diisopropyl ether (DIPE).
4. Separation step: the precipitate was collected by filtration. 5.
5. Yield: 51 37 g of intermediate were obtained in 96% yield. | | References | [1] Patent: WO2013/10904, 2013, A1. Location in patent: Page/Page column 76
[2] Bioorganic and Medicinal Chemistry Letters, 2013, vol. 23, # 17, p. 4794 - 4800
[3] Patent: KR2015/77599, 2015, A. Location in patent: Paragraph 0096; 0099-0101
[4] Patent: KR101601354, 2016, B1. Location in patent: Paragraph 0110 - 0112
[5] Patent: US2011/190269, 2011, A1. Location in patent: Page/Page column 66 |
| | 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine Preparation Products And Raw materials |
|