|
|
| | Ammonium tetrachloroaurate Basic information | | Application |
| | Ammonium tetrachloroaurate Chemical Properties |
| Melting point | 520°C | | solubility | H2O: slightly soluble(lit.) | | form | Crystalline Powder | | color | Yellow-orange | | Water Solubility | Soluble in water and alcohol | | Major Application | electroplating material synthesis precursor | | InChI | 1S/Au.4ClH.H3N.H2O/h;4*1H;1H3;1H2/q+3;;;;;;/p-3 | | InChIKey | DTYXSEJVOCMIPK-UHFFFAOYSA-K | | SMILES | O.[H][N+]([H])([H])[H].Cl[Au-](Cl)(Cl)Cl |
| Hazard Codes | Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 36/37-26 | | WGK Germany | 3 | | TSCA | Yes | | HazardClass | 8 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ammonium tetrachloroaurate Usage And Synthesis |
| Application | CN201611093192.0 reports a method for preparing Pd-Au alloy films by electroless plating on the surface of porous ceramic or porous metal substrates, belonging to the field of electroless plating applications. Its characteristic is the gold plating process used to prepare Pd-Au alloy films. | | Chemical Properties | yellow crystal(s) [STR93] |
| | Ammonium tetrachloroaurate Preparation Products And Raw materials |
|