|
|
| | Ammeline-13C3 Basic information |
| | Ammeline-13C3 Chemical Properties |
| Melting point | >300°C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly, Heated) | | form | Solid | | color | White to Pale Purple | | Stability: | Hygroscopic | | InChI | 1S/C3H5N5O/c4-1-6-2(5)8-3(9)7-1/h(H5,4,5,6,7,8,9)/i1+1,2+1,3+1 | | InChIKey | MASBWURJQFFLOO-VMIGTVKRSA-N | | SMILES | N[13c]1n[13c](N)n[13c](O)n1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | Ammeline-13C3 Usage And Synthesis |
| Chemical Properties | Off-White Soid | | Uses | A labelled related compound of Melamine. |
| | Ammeline-13C3 Preparation Products And Raw materials |
|