- Deterenol Hydrochloride
-
- $15.00 / 25kg
-
2025-09-03
- CAS:23239-36-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000tons
|
| | Deterenol Hydrochloride Basic information |
| | Deterenol Hydrochloride Chemical Properties |
| Melting point | 155-157 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H17NO2.ClH/c1-8(2)12-7-11(14)9-3-5-10(13)6-4-9;/h3-6,8,11-14H,7H2,1-2H3;1H | | InChIKey | KTOGVIILDSYTNS-UHFFFAOYSA-N | | SMILES | c1cc(C(O)CNC(C)C)ccc1O.Cl |
| | Deterenol Hydrochloride Usage And Synthesis |
| Uses | Deterenol Hydrochloride is an effective, nonmydriatic and nonmiotic hypotensive agent with intraocular pressure (IOP) effects similar to epinephrine bitartrate in rhesus monkeys when administered at approx. twice the concentration of epinephrine used clinically. |
| | Deterenol Hydrochloride Preparation Products And Raw materials |
|