|
|
| | 6β-Hydroxy Norgestrel Basic information |
| | 6β-Hydroxy Norgestrel Chemical Properties |
| Melting point | 200-202 °C | | Boiling point | 504.1±50.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Soluble, Sonicated), DMSO (Slightly, Sonicated), Methanol (Slightly) | | pka | 13.03±0.60(Predicted) | | form | Solid | | color | White to Pale Yellow | | InChIKey | LUDPEOWAWHAHEP-QUEDAVJPNA-N | | SMILES | C1C[C@@H]2[C@H]3CCC4(CC)[C@@](C#C)(O)CC[C@H]4[C@@H]3C[C@@H](O)C2=CC1=O |&1:2,3,9,15,16,18,r| |
| | 6β-Hydroxy Norgestrel Usage And Synthesis |
| Uses | A hydroxylated impurity of Norgestrel | | Uses | 6β-Hydroxylevonorgestrel is an impurity from the synthesis of Levonorgestrel (N689510), an oral contraceptive. | | Uses | 6β-Hydroxylevonorgestrel (Levonorgestrel EP Impurity H) is an impurity from the synthesis of Levonorgestrel (N689510), an oral contraceptive. |
| | 6β-Hydroxy Norgestrel Preparation Products And Raw materials |
|