- 2-N-Propyl Pramipexole
-
- $70.00
-
2026-07-06
- CAS:1246815-83-7
- Min. Order: 10kg
- Purity: 0.99
- Supply Ability: 20tons
|
| | 2-N-Propyl Pramipexole Basic information |
| Product Name: | 2-N-Propyl Pramipexole | | Synonyms: | 2-N-Propyl Pramipexole;(S)-4,5,6,7-Tetrahydro-N2-propyl-N6-propyl-2,6-benzothiazolediaMine;PraMipexole IMpurity B;2,6-BenzothiazolediaMine, 4,5, 6,7-tetrahydro-N2,N6-dipropyl-, (6S)-;Pramipexole Impurity B HCl;(6S)-2-N,6-N-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;Pramipexole impurity 3/Pramipexole EP Impurity B/2-N-Propyl Pramipexole;(S)-N2,N6-dipropyl-4,5,6,7-tetrahydrobenzo[d]thiazole-2,6-diamine | | CAS: | 1246815-83-7 | | MF: | C13H23N3S | | MW: | 253.41 | | EINECS: | | | Product Categories: | Amines;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 1246815-83-7.mol |  |
| | 2-N-Propyl Pramipexole Chemical Properties |
| Melting point | 107-110°C | | Boiling point | 383.6±52.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Dichloromethane (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 9.49±0.20(Predicted) | | color | White to Pale Beige | | InChI | InChI=1/C13H23N3S/c1-3-7-14-10-5-6-11-12(9-10)17-13(16-11)15-8-4-2/h10,14H,3-9H2,1-2H3,(H,15,16)/t10-/s3 | | InChIKey | NSHVRDSQVRQBFT-JQHDBZEONA-N | | SMILES | C1c2sc(NCCC)nc2CC[C@H]1NCCC |&1:12,r| |
| | 2-N-Propyl Pramipexole Usage And Synthesis |
| Chemical Properties | Off-White to Pale Beige Solid | | Uses | 2-N-Propyl Pramipexole (Pramipexole EP Impurity B; Pramipexole BP Impurity B) is a Pramipexole derivative. |
| | 2-N-Propyl Pramipexole Preparation Products And Raw materials |
|