|
|
| | 3,4-Dimethoxyhydrocinnamic acid Basic information |
| Product Name: | 3,4-Dimethoxyhydrocinnamic acid | | Synonyms: | 3-(3,4-DiMethoxyphenyl)propionic acid, 99% 50GR;3-(3,4-DiMethoxy)phenyl Proponoic Acid;3,4-DiMethoxy-benzenepropanoic acid;3-(3,4-Dimethoxyphenyl)propanonic acid 99%;3,4-Dimethoxyhydrocinnamic acid, 3-(3,4-Dimethoxyphenyl)propionic acid;3-(3,4- twoMethoxy phenyl)propionic acid;DiMethoxyphenyl)propionic ac;3-(3,4-DiMethoxyphenyl)propionic Acid, 97+% | | CAS: | 2107-70-2 | | MF: | C11H14O4 | | MW: | 210.23 | | EINECS: | 218-288-3 | | Product Categories: | intermediate;Aromatics, Metabolites & Impurities;Aromatics;Aromatic Propionic Acids;Cinnamic acid;Organic acids | | Mol File: | 2107-70-2.mol |  |
| | 3,4-Dimethoxyhydrocinnamic acid Chemical Properties |
| Melting point | 96-97 °C(lit.) | | Boiling point | 309.75°C (rough estimate) | | density | 1.1922 (rough estimate) | | refractive index | 1.5384 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Water | | pka | 4.71±0.10(Predicted) | | form | Crystalline Powder | | color | Slightly beige | | BRN | 2696272 | | InChI | InChI=1S/C11H14O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3,5,7H,4,6H2,1-2H3,(H,12,13) | | InChIKey | LHHKQWQTBCTDQM-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(OC)C(OC)=C1 | | CAS DataBase Reference | 2107-70-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(3,4-Dimethoxyphenyl)-propionic acid(2107-70-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189090 | | Storage Class | 11 - Combustible Solids |
| | 3,4-Dimethoxyhydrocinnamic acid Usage And Synthesis |
| Chemical Properties | Slightly beige crystalline powder | | Uses | 3-(3,4-Dimethoxyphenyl)propanoic Acid is one of the novel circulating coffee metabolites in human plasma. | | Uses | 3-(3,4-Dimethoxyphenyl)propionic acid was used in screening of short-chain fatty acid derivatives for the ability to induce γ globin gene expression in reporter assays and erythropoiesis in vivo. | | Definition | ChEBI: A monocarboxylic acid that is propanoic acid substituted by a 3,4-dimethoxyphenyl group at position 3. | | General Description | 3-(3,4-Dimethoxyphenyl)propionic acid (3,4-Dimethoxyhydrocinnamic acid) forms complex with copper (II). | | in vivo | 3-(3,4-Dimethoxyphenyl)propanoic acid (50, 150 mg/kg of iv or 50, 150, 200 mg/kg of orally) achieves concentrations significantly higher than targeted plasma levels for several hours after single 50 to 150 mg/kg doses[1]. |
| | 3,4-Dimethoxyhydrocinnamic acid Preparation Products And Raw materials |
| Raw materials | 1,3-Dioxane-4,6-dione, 2-phenyl--->5-[(3,4-dimethoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione-->5-(3,4-dimethoxybenzyl)-2,2-dimethyl-1,3-dioxane-4,6-dione-->3-(2-METHOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER-->ETHYL 3-(3,4-DIMETHOXYPHENYL)ACRYLATE-->3,4-DIMETHOXYCINNAMIC ACID-->Dihydrocaffeic acid-->Veratraldehyde-->Methanol-->2,2-Dimethyl-1,3-dioxane-4,6-dione-->3,4-Dimethoxycinnamic acid |
|