E3,Z8,Z11-Tetradecatriene acetate manufacturers
|
| | E3,Z8,Z11-Tetradecatriene acetate Basic information |
| Product Name: | E3,Z8,Z11-Tetradecatriene acetate | | Synonyms: | (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate;E3,Z8,Z11-Tetradecatriene acetate;3,8,11-Tetradecatrien-1-ol, acetate, (3E,8Z,11Z)- (9CI);Tuta Absoluta PheroMone (Major);E3Z8Z11-14Ac;(3E,8Z,11Z)-Tetradeca-3,8,11-trienyl acetate;(E,Z,Z)-3,8,11-Tetradecatrienyl acetate;Tuta absoluta Pheromone blend | | CAS: | 163041-94-9 | | MF: | C16H26O2 | | MW: | 250.38 | | EINECS: | | | Product Categories: | | | Mol File: | 163041-94-9.mol |  |
| | E3,Z8,Z11-Tetradecatriene acetate Chemical Properties |
| Boiling point | 333.6±31.0 °C(Predicted) | | density | 0.903±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Light Sensitive | | InChI | InChI=1S/C16H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5,7-8,12-13H,3,6,9-11,14-15H2,1-2H3/b5-4-,8-7-,13-12+ | | InChIKey | HWPJPNQEVWTZSJ-XBZOLNABSA-N | | SMILES | C(OC(=O)C)C/C=C/CCC/C=C\C/C=C\CC | | EPA Substance Registry System | 3,8,11-Tetradecatrien-1-ol, acetate, (3E,8Z,11Z)- (163041-94-9) |
| | E3,Z8,Z11-Tetradecatriene acetate Usage And Synthesis |
| Uses | (3E,8Z,11Z)-Tetradeca-3,8,11-trienyl Acetate is a compound found in the pheromones. It is a major sex pheromone component of the tomato pest. | | Definition | ChEBI: 3E,8Z,11Z-Tetradecatrienyl acetate is a carboxylic ester. |
| | E3,Z8,Z11-Tetradecatriene acetate Preparation Products And Raw materials |
|