|
|
| | indol-5-ylsulfonyl chloride Basic information |
| | indol-5-ylsulfonyl chloride Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C8H6ClNO2S/c9-13(11,12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10H | | InChIKey | MZGMZFOGQIBZLB-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(S(Cl)(=O)=O)C=C2)C=C1 |
| | indol-5-ylsulfonyl chloride Usage And Synthesis |
| Uses | 1H-Indole-5-sulfonyl Chloride is being used as a reagent in the preparation of sulphonamide derivatives of benzylamine for the treatment of CNS diseases. |
| | indol-5-ylsulfonyl chloride Preparation Products And Raw materials |
|