| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,4-Difluoro-benzenesulfonic acid Basic information |
| | 3,4-Difluoro-benzenesulfonic acid Chemical Properties |
| density | 1.609 | | pka | -0.95±0.50(Predicted) | | form | solid | | InChI | 1S/C6H4F2O3S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,(H,9,10,11) | | InChIKey | BHVOQJHAIJQXNK-UHFFFAOYSA-N | | SMILES | FC1=CC(S(=O)(O)=O)=CC=C1F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 3,4-Difluoro-benzenesulfonic acid Usage And Synthesis |
| | 3,4-Difluoro-benzenesulfonic acid Preparation Products And Raw materials |
|