|
|
| | 2,4,6-Tribromophenyl acrylate Basic information |
| Product Name: | 2,4,6-Tribromophenyl acrylate | | Synonyms: | 2,4,6-TRIBROMOPHENYL ACRYLATE;2-propenoicacid,2,4,6-tribromophenylester;2,4,6-TRIBROMOPHENYL ACRYLATE, TRIBROMOPHENYL ACRYLATE;2,4,6-Tribromophenyl 2-propenoate;2.4.6-TRIBROMOPHENYL ACRYLATE 99%;TRIBROMOPHENYL ACRYLATE (TBPA);Acrylic acid 2,4,6-tribromophenyl ester;Propenoic acid 2,4,6-tribromophenyl ester | | CAS: | 3741-77-3 | | MF: | C9H5Br3O2 | | MW: | 384.85 | | EINECS: | 223-132-2 | | Product Categories: | monomer;Aromatic Compounds | | Mol File: | 3741-77-3.mol |  |
| | 2,4,6-Tribromophenyl acrylate Chemical Properties |
| Melting point | 76.0 to 80.0 °C | | Boiling point | 380.8±42.0 °C(Predicted) | | density | 2.055±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystaline | | color | White to Almost white | | InChI | InChI=1S/C9H5Br3O2/c1-2-8(13)14-9-6(11)3-5(10)4-7(9)12/h2-4H,1H2 | | InChIKey | CNLVUQQHXLTOTC-UHFFFAOYSA-N | | SMILES | C(OC1=C(Br)C=C(Br)C=C1Br)(=O)C=C | | CAS DataBase Reference | 3741-77-3(CAS DataBase Reference) | | EPA Substance Registry System | 2,4,6-Tribromophenyl acrylate (3741-77-3) |
| | 2,4,6-Tribromophenyl acrylate Usage And Synthesis |
| | 2,4,6-Tribromophenyl acrylate Preparation Products And Raw materials |
|