|
|
| | 3-AMino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone Basic information |
| | 3-AMino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone Chemical Properties |
| Melting point | >290°C (dec.) | | Boiling point | 566.8±50.0 °C(Predicted) | | density | 1.477±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | pka | 9.18±0.70(Predicted) | | form | solid | | color | Yellow to Dark Yellow | | BRN | 5596577 | | Major Application | pharmaceutical pharmaceutical small molecule | | InChI | 1S/C15H10ClN3O3/c16-11-4-2-1-3-9(11)13-10-7-8(19(21)22)5-6-12(10)18-15(20)14(13)17/h1-7H,17H2,(H,18,20) | | InChIKey | GYAWOVGCEQLWHW-UHFFFAOYSA-N | | SMILES | NC1=C(C2=C(Cl)C=CC=C2)C3=C(NC1=O)C=CC([N+]([O-])=O)=C3 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 STOT SE 3 |
| | 3-AMino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Clonazepam (C587080) impurity in active substance and tablets. | | Uses | Labelled Clonazepam (C587080) impurity. | | Uses | 3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone (Clonazepam EP Impurity B) is an impurity of Clonazepam (C587080), antiepileptic agent with anxiolytic and antimanic properties. |
| | 3-AMino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone Preparation Products And Raw materials |
|