| Company Name: |
XIAMEN SINOPEG BIOTECH CO., LTD. |
| Tel: |
+86-0592-7761068 +8617350879715 |
| Email: |
changaiwei@sinopeg.com |
| Products Intro: |
Product Name:2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaoctatriacontan-38-oic acid CAS:2135793-73-4 Purity:98% Package:1g;|10g;|100g;
|
|
|
|
|
MPEG11-CH2CH2COOH manufacturers
- 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaoctatriacontan-38-oic acid
-
- $0.00 / 1g
-
2026-02-05
- CAS:2135793-73-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- mPEG11-CH2CH2COOH
-
- $0.00 / 1g
-
2026-01-28
- CAS:2135793-73-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
- m-PEG12-COOH
-
- $0.00 / 5g
-
2025-06-07
- CAS:2135793-73-4
- Min. Order: 5g
- Purity: >95.00%
- Supply Ability: 5g
|
| | MPEG11-CH2CH2COOH Basic information |
| Product Name: | MPEG11-CH2CH2COOH | | Synonyms: | MPEG11-CH2CH2COOH;mPEG11-COOH;4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic acid;Methyl-PEG12-Carboxylic Acid;2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic Acid;m-dPEG12-acid;Inhibitor,m-PEG-12-acid,m PEG12 acid,mPEG12acid,PROTAC Linkers,inhibit;mPEG11-CH2CH2COOH/4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic acid | | CAS: | 2135793-73-4 | | MF: | C26H52O14 | | MW: | 588.68 | | EINECS: | | | Product Categories: | peg | | Mol File: | 2135793-73-4.mol |  |
| | MPEG11-CH2CH2COOH Chemical Properties |
| Boiling point | 628.8±55.0 °C(Predicted) | | density | 1.113±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | liquid | | pka | 4.28±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C26H52O14/c1-29-4-5-31-8-9-33-12-13-35-16-17-37-20-21-39-24-25-40-23-22-38-19-18-36-15-14-34-11-10-32-7-6-30-3-2-26(27)28/h2-25H2,1H3,(H,27,28) | | InChIKey | JMAKFNFKUHXFBH-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
| | MPEG11-CH2CH2COOH Usage And Synthesis |
| Description | m-PEG12-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | MeO-?PEG(12)?-?COOH is used in the preparation of fishbone-?like polymer brushes with potential applications in the production of smart materials and biosensors. | | IC 50 | PEGs |
| | MPEG11-CH2CH2COOH Preparation Products And Raw materials |
|